C23H30F2N4O6 — CID 68534067
[4-[6-[2,5-difluoro-4-(2-methoxyethoxy)anilino]-5-methylpyrimidin-4-yl]oxypiperidin-1-yl] propan-2-yl carbonate (PubChem CID 68534067) has the molecular formula C23H30F2N4O6 and a molecular weight of 496.51 g/mol. Its IUPAC name is [4-[6-[2,5-difluoro-4-(2-methoxyethoxy)anilino]-5-methylpyrimidin-4-yl]oxypiperidin-1-yl] propan-2-yl carbonate.
| Compound Name | [4-[6-[2,5-difluoro-4-(2-methoxyethoxy)anilino]-5-methylpyrimidin-4-yl]oxypiperidin-1-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 68534067 |
| Molecular Formula | C23H30F2N4O6 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | [4-[6-[2,5-difluoro-4-(2-methoxyethoxy)anilino]-5-methylpyrimidin-4-yl]oxypiperidin-1-yl] propan-2-yl carbonate |
| SMILES | COCCOc1cc(F)c(Nc2ncnc(OC3CCN(OC(=O)OC(C)C)CC3)c2C)cc1F |
| InChI | InChI=1S/C23H30F2N4O6/c1-14(2)33-23(30)35-29-7-5-16(6-8-29)34-22-15(3)21(26-13-27-22)28-19-11-18(25)20(12-17(19)24)32-10-9-31-4/h11-14,16H,5-10H2,1-4H3,(H,26,27,28) |
| InChIKey | YZMDCSGAOWKXIH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|