C20H23BrF2N4O4 — CID 68534036
[4-[6-(4-bromo-2,5-difluoroanilino)-5-methylpyrimidin-4-yl]oxypiperidin-1-yl] propan-2-yl carbonate (PubChem CID 68534036) has the molecular formula C20H23BrF2N4O4 and a molecular weight of 501.33 g/mol. Its IUPAC name is [4-[6-(4-bromo-2,5-difluoroanilino)-5-methylpyrimidin-4-yl]oxypiperidin-1-yl] propan-2-yl carbonate.
| Compound Name | [4-[6-(4-bromo-2,5-difluoroanilino)-5-methylpyrimidin-4-yl]oxypiperidin-1-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 68534036 |
| Molecular Formula | C20H23BrF2N4O4 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | [4-[6-(4-bromo-2,5-difluoroanilino)-5-methylpyrimidin-4-yl]oxypiperidin-1-yl] propan-2-yl carbonate |
| SMILES | Cc1c(Nc2cc(F)c(Br)cc2F)ncnc1OC1CCN(OC(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C20H23BrF2N4O4/c1-11(2)29-20(28)31-27-6-4-13(5-7-27)30-19-12(3)18(24-10-25-19)26-17-9-15(22)14(21)8-16(17)23/h8-11,13H,4-7H2,1-3H3,(H,24,25,26) |
| InChIKey | RYGCPYNXRGHZQJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|