About [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate
[4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate (PubChem CID 68564988) has the molecular formula C21H26FN3O7S
and a molecular weight of 483.52 g/mol. Its IUPAC name is [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate.
Molecular Properties
| Compound Name | [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate |
| PubChem CID | 68564988 |
| Molecular Formula | C21H26FN3O7S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)ON1CCC(Oc2ccnc(Nc3ccc(S(C)(=O)=O)cc3F)c2O)CC1 |
| InChI | InChI=1S/C21H26FN3O7S/c1-13(2)30-21(27)32-25-10-7-14(8-11-25)31-18-6-9-23-20(19(18)26)24-17-5-4-15(12-16(17)22)33(3,28)29/h4-6,9,12-14,26H,7-8,10-11H2,1-3H3,(H,23,24) |
| InChIKey | MBSQVFUCAUIDRY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate?
The IUPAC name of [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate (CID 68564988) is [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate.
What is the SMILES notation for [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate?
The canonical SMILES for [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate is CC(C)OC(=O)ON1CCC(Oc2ccnc(Nc3ccc(S(C)(=O)=O)cc3F)c2O)CC1.
What is the InChIKey of [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate?
The InChIKey is MBSQVFUCAUIDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26FN3O7S/c1-13(2)30-21(27)32-25-10-7-14(8-11-25)31-18-6-9-23-20(19(18)26)24-17-5-4-15(12-16(17)22)33(3,28)29/h4-6,9,12-14,26H,7-8,10-11H2,1-3H3,(H,23,24).
What are the key properties of [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate?
[4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate has a molecular weight of 483.52 g/mol, XLogP of 3.39, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[2-(2-fluoro-4-methylsulfonylanilino)-3-hydroxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate is sourced from PubChem (CID 68564988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).