C21H23N5S — CID 172601045
N-(1-ethenylsulfanylpiperidin-4-yl)-5-(3-methyl-4-pyridinyl)-2,6-naphthyridin-3-amine (PubChem CID 172601045) has the molecular formula C21H23N5S and a molecular weight of 377.52 g/mol. Its IUPAC name is N-(1-ethenylsulfanylpiperidin-4-yl)-5-(3-methyl-4-pyridinyl)-2,6-naphthyridin-3-amine.
| Compound Name | N-(1-ethenylsulfanylpiperidin-4-yl)-5-(3-methyl-4-pyridinyl)-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172601045 |
| Molecular Formula | C21H23N5S |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(1-ethenylsulfanylpiperidin-4-yl)-5-(3-methyl-4-pyridinyl)-2,6-naphthyridin-3-amine |
| SMILES | C=CSN1CCC(Nc2cc3c(-c4ccncc4C)nccc3cn2)CC1 |
| InChI | InChI=1S/C21H23N5S/c1-3-27-26-10-6-17(7-11-26)25-20-12-19-16(14-24-20)4-9-23-21(19)18-5-8-22-13-15(18)2/h3-5,8-9,12-14,17H,1,6-7,10-11H2,2H3,(H,24,25) |
| InChIKey | XYGWSRCEWGDQKS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|