C21H24N4OS — CID 172600250
[4-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridin-1-yl]phenyl]methanol (PubChem CID 172600250) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is [4-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridin-1-yl]phenyl]methanol.
| Compound Name | [4-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 172600250 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [4-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridin-1-yl]phenyl]methanol |
| SMILES | CSN1CCC(Nc2cc3c(-c4ccc(CO)cc4)nccc3cn2)CC1 |
| InChI | InChI=1S/C21H24N4OS/c1-27-25-10-7-18(8-11-25)24-20-12-19-17(13-23-20)6-9-22-21(19)16-4-2-15(14-26)3-5-16/h2-6,9,12-13,18,26H,7-8,10-11,14H2,1H3,(H,23,24) |
| InChIKey | GPGQXKUXIWUESS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|