C22H20N4O3 — CID 18374812
2-anilino-8-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18374812) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-anilino-8-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-anilino-8-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18374812 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-anilino-8-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1cc(Cn2c(=O)ccc3cnc(Nc4ccccc4)nc32)cc(OC)c1 |
| InChI | InChI=1S/C22H20N4O3/c1-28-18-10-15(11-19(12-18)29-2)14-26-20(27)9-8-16-13-23-22(25-21(16)26)24-17-6-4-3-5-7-17/h3-13H,14H2,1-2H3,(H,23,24,25) |
| InChIKey | HNSULVLPBSSIQJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |