C20H24N4O3 — CID 70112013
2-(3,4-dimethoxyanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 70112013) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(3,4-dimethoxyanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70112013 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-(3,4-dimethoxyanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCCn1c(=O)ccc2cnc(Nc3ccc(OC)c(OC)c3)nc21 |
| InChI | InChI=1S/C20H24N4O3/c1-4-5-6-11-24-18(25)10-7-14-13-21-20(23-19(14)24)22-15-8-9-16(26-2)17(12-15)27-3/h7-10,12-13H,4-6,11H2,1-3H3,(H,21,22,23) |
| InChIKey | OIGAJEHFPRQXJD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|