C18H20N4O2 — CID 70112446
2-(3-hydroxyanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 70112446) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(3-hydroxyanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(3-hydroxyanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70112446 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-(3-hydroxyanilino)-8-pentylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCCn1c(=O)ccc2cnc(Nc3cccc(O)c3)nc21 |
| InChI | InChI=1S/C18H20N4O2/c1-2-3-4-10-22-16(24)9-8-13-12-19-18(21-17(13)22)20-14-6-5-7-15(23)11-14/h5-9,11-12,23H,2-4,10H2,1H3,(H,19,20,21) |
| InChIKey | GBGDYICIJTURKE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|