C18H26OP- — CID 141022952
[4-(4-tert-butyl-2-methylbenzoyl)cyclohexyl]phosphanide (PubChem CID 141022952) has the molecular formula C18H26OP- and a molecular weight of 289.38 g/mol. Its IUPAC name is [4-(4-tert-butyl-2-methylbenzoyl)cyclohexyl]phosphanide.
| Compound Name | [4-(4-tert-butyl-2-methylbenzoyl)cyclohexyl]phosphanide |
|---|---|
| PubChem CID | 141022952 |
| Molecular Formula | C18H26OP- |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [4-(4-tert-butyl-2-methylbenzoyl)cyclohexyl]phosphanide |
| SMILES | Cc1cc(C(C)(C)C)ccc1C(=O)C1CCC([PH-])CC1 |
| InChI | InChI=1S/C18H26OP/c1-12-11-14(18(2,3)4)7-10-16(12)17(19)13-5-8-15(20)9-6-13/h7,10-11,13,15,20H,5-6,8-9H2,1-4H3/q-1 |
| InChIKey | MWDCBIOTVUBVMX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|