C24H47NO7 — CID 141024076
decyl (3R,4R,5S,6R)-3-[hexan-2-yl(methyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate (PubChem CID 141024076) has the molecular formula C24H47NO7 and a molecular weight of 461.64 g/mol. Its IUPAC name is decyl (3R,4R,5S,6R)-3-[hexan-2-yl(methyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate.
| Compound Name | decyl (3R,4R,5S,6R)-3-[hexan-2-yl(methyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 141024076 |
| Molecular Formula | C24H47NO7 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.34 |
| IUPAC Name | decyl (3R,4R,5S,6R)-3-[hexan-2-yl(methyl)amino]-2,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)C1N(C)C(C)CCCC |
| InChI | InChI=1S/C24H47NO7/c1-5-7-9-10-11-12-13-14-16-31-23(29)24(30)22(25(4)18(3)15-8-6-2)21(28)20(27)19(17-26)32-24/h18-22,26-28,30H,5-17H2,1-4H3/t18?,19-,20-,21+,22?,24?/m1/s1 |
| InChIKey | TWCAPBPSPZAKQN-KVCAOYPYSA-N |
| XLogP | 2.35 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|