C11H19NO8 — CID 170850315
(2S,3S,4R,5R,6S)-6-[carboxy-(trimethylazaniumyl)methyl]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 170850315) has the molecular formula C11H19NO8 and a molecular weight of 293.27 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-6-[carboxy-(trimethylazaniumyl)methyl]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | (2S,3S,4R,5R,6S)-6-[carboxy-(trimethylazaniumyl)methyl]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 170850315 |
| Molecular Formula | C11H19NO8 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (2S,3S,4R,5R,6S)-6-[carboxy-(trimethylazaniumyl)methyl]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | C[N+](C)(C)C(C(=O)O)[C@@H]1O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO8/c1-12(2,3)4(10(16)17)8-6(14)5(13)7(15)9(20-8)11(18)19/h4-9,13-15H,1-3H3,(H-,16,17,18,19)/t4?,5-,6-,7+,8+,9+/m1/s1 |
| InChIKey | JAAURIOCOPGDLK-ICPASMAVSA-N |
| XLogP | -4.25 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|