C21H24O7S — CID 14102424
6-methoxy-7-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 14102424) has the molecular formula C21H24O7S and a molecular weight of 420.48 g/mol. Its IUPAC name is 6-methoxy-7-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | 6-methoxy-7-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 14102424 |
| Molecular Formula | C21H24O7S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 6-methoxy-7-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | COC1OC2COC(c3ccccc3)OC2C(O)C1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H24O7S/c1-13-8-10-15(11-9-13)29(23,24)19-17(22)18-16(27-21(19)25-2)12-26-20(28-18)14-6-4-3-5-7-14/h3-11,16-22H,12H2,1-2H3 |
| InChIKey | MWXQPZBKLWINGN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |