C21H22O6S — CID 14102438
(4aR,6R,8aS)-6-methoxy-7-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine (PubChem CID 14102438) has the molecular formula C21H22O6S and a molecular weight of 402.47 g/mol. Its IUPAC name is (4aR,6R,8aS)-6-methoxy-7-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,8aS)-6-methoxy-7-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 14102438 |
| Molecular Formula | C21H22O6S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (4aR,6R,8aS)-6-methoxy-7-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2C=C1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22O6S/c1-14-8-10-16(11-9-14)28(22,23)19-12-17-18(27-21(19)24-2)13-25-20(26-17)15-6-4-3-5-7-15/h3-12,17-18,20-21H,13H2,1-2H3/t17-,18+,20?,21+/m0/s1 |
| InChIKey | VSTWTBUVTHDFJX-GOVXWBHASA-N |
| XLogP | 3.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |