About (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate
(5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate (PubChem CID 141024660) has the molecular formula C9H6ClNO3S
and a molecular weight of 243.67 g/mol. Its IUPAC name is (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate.
Molecular Properties
| Compound Name | (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate |
| PubChem CID | 141024660 |
| Molecular Formula | C9H6ClNO3S |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate |
| SMILES | CC(=O)Oc1cc(Cl)cc2[nH]c(=S)oc12 |
| InChI | InChI=1S/C9H6ClNO3S/c1-4(12)13-7-3-5(10)2-6-8(7)14-9(15)11-6/h2-3H,1H3,(H,11,15) |
| InChIKey | GSMGIBLDINELJQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate?
The IUPAC name of (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate (CID 141024660) is (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate.
What is the SMILES notation for (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate?
The canonical SMILES for (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate is CC(=O)Oc1cc(Cl)cc2[nH]c(=S)oc12.
What is the InChIKey of (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate?
The InChIKey is GSMGIBLDINELJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO3S/c1-4(12)13-7-3-5(10)2-6-8(7)14-9(15)11-6/h2-3H,1H3,(H,11,15).
What are the key properties of (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate?
(5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate has a molecular weight of 243.67 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-sulfanylidene-3H-1,3-benzoxazol-7-yl) acetate is sourced from PubChem (CID 141024660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).