C17H34O2Si2 — CID 141024686
tert-butyl-dimethyl-[[4-(2-trimethylsilylethynyl)oxan-2-yl]methoxy]silane (PubChem CID 141024686) has the molecular formula C17H34O2Si2 and a molecular weight of 326.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[4-(2-trimethylsilylethynyl)oxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[4-(2-trimethylsilylethynyl)oxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 141024686 |
| Molecular Formula | C17H34O2Si2 |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | tert-butyl-dimethyl-[[4-(2-trimethylsilylethynyl)oxan-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CC(C#C[Si](C)(C)C)CCO1 |
| InChI | InChI=1S/C17H34O2Si2/c1-17(2,3)21(7,8)19-14-16-13-15(9-11-18-16)10-12-20(4,5)6/h15-16H,9,11,13-14H2,1-8H3 |
| InChIKey | QDYDKQNVSTVENI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|