C13H21NO2 — CID 141026926
2-[(1R,3R)-3-[[methyl(prop-2-ynyl)amino]methyl]cyclohexyl]acetic acid (PubChem CID 141026926) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-[(1R,3R)-3-[[methyl(prop-2-ynyl)amino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[(1R,3R)-3-[[methyl(prop-2-ynyl)amino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 141026926 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-[(1R,3R)-3-[[methyl(prop-2-ynyl)amino]methyl]cyclohexyl]acetic acid |
| SMILES | C#CCN(C)C[C@@H]1CCC[C@@H](CC(=O)O)C1 |
| InChI | InChI=1S/C13H21NO2/c1-3-7-14(2)10-12-6-4-5-11(8-12)9-13(15)16/h1,11-12H,4-10H2,2H3,(H,15,16)/t11-,12-/m1/s1 |
| InChIKey | MUDZVNOAHNILCW-VXGBXAGGSA-N |
| XLogP | 1.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|