C12H22O2 — CID 57180038
2-[(1R,3R)-3-tert-butylcyclohexyl]acetic acid (PubChem CID 57180038) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-[(1R,3R)-3-tert-butylcyclohexyl]acetic acid.
| Compound Name | 2-[(1R,3R)-3-tert-butylcyclohexyl]acetic acid |
|---|---|
| PubChem CID | 57180038 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-[(1R,3R)-3-tert-butylcyclohexyl]acetic acid |
| SMILES | CC(C)(C)[C@@H]1CCC[C@@H](CC(=O)O)C1 |
| InChI | InChI=1S/C12H22O2/c1-12(2,3)10-6-4-5-9(7-10)8-11(13)14/h9-10H,4-8H2,1-3H3,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | CLRGQGGEYJZYQT-NXEZZACHSA-N |
| XLogP | 3.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |