C25H31N5O — CID 141028582
4-[1-(4-benzylpiperazin-1-yl)cyclohexyl]benzimidazole-4-carboxamide (PubChem CID 141028582) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 4-[1-(4-benzylpiperazin-1-yl)cyclohexyl]benzimidazole-4-carboxamide.
| Compound Name | 4-[1-(4-benzylpiperazin-1-yl)cyclohexyl]benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 141028582 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 4-[1-(4-benzylpiperazin-1-yl)cyclohexyl]benzimidazole-4-carboxamide |
| SMILES | NC(=O)C1(C2(N3CCN(Cc4ccccc4)CC3)CCCCC2)C=CC=C2N=CN=C21 |
| InChI | InChI=1S/C25H31N5O/c26-23(31)25(13-7-10-21-22(25)28-19-27-21)24(11-5-2-6-12-24)30-16-14-29(15-17-30)18-20-8-3-1-4-9-20/h1,3-4,7-10,13,19H,2,5-6,11-12,14-18H2,(H2,26,31) |
| InChIKey | LGEYHUGAORKKSP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |