C13H26O3 — CID 141028635
(1-hydroxy-2,2-dimethylpropyl) octanoate (PubChem CID 141028635) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (1-hydroxy-2,2-dimethylpropyl) octanoate.
| Compound Name | (1-hydroxy-2,2-dimethylpropyl) octanoate |
|---|---|
| PubChem CID | 141028635 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (1-hydroxy-2,2-dimethylpropyl) octanoate |
| SMILES | CCCCCCCC(=O)OC(O)C(C)(C)C |
| InChI | InChI=1S/C13H26O3/c1-5-6-7-8-9-10-11(14)16-12(15)13(2,3)4/h12,15H,5-10H2,1-4H3 |
| InChIKey | ZGUOKHVGVBCINU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|