About ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate
ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate (PubChem CID 141029816) has the molecular formula C6H14O9S3
and a molecular weight of 326.37 g/mol. Its IUPAC name is ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate.
Molecular Properties
| Compound Name | ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate |
| PubChem CID | 141029816 |
| Molecular Formula | C6H14O9S3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate |
| SMILES | CCS(=O)(=O)OOS(=O)(=O)CCCOS(C)(=O)=O |
| InChI | InChI=1S/C6H14O9S3/c1-3-17(9,10)14-15-18(11,12)6-4-5-13-16(2,7)8/h3-6H2,1-2H3 |
| InChIKey | FYIPWIPFLRHSJC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate?
The IUPAC name of ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate (CID 141029816) is ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate.
What is the SMILES notation for ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate?
The canonical SMILES for ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate is CCS(=O)(=O)OOS(=O)(=O)CCCOS(C)(=O)=O.
What is the InChIKey of ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate?
The InChIKey is FYIPWIPFLRHSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O9S3/c1-3-17(9,10)14-15-18(11,12)6-4-5-13-16(2,7)8/h3-6H2,1-2H3.
What are the key properties of ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate?
ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate has a molecular weight of 326.37 g/mol, XLogP of -1.02, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfonyloxy 3-methylsulfonyloxypropane-1-sulfonate is sourced from PubChem (CID 141029816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).