C34H31NO5 — CID 141030052
3-ethyl-2-methyl-4-phenylmethoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid (PubChem CID 141030052) has the molecular formula C34H31NO5 and a molecular weight of 533.62 g/mol. Its IUPAC name is 3-ethyl-2-methyl-4-phenylmethoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid.
| Compound Name | 3-ethyl-2-methyl-4-phenylmethoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 141030052 |
| Molecular Formula | C34H31NO5 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 3-ethyl-2-methyl-4-phenylmethoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid |
| SMILES | CCc1c(OCc2ccccc2)cc(OCc2cccc(OCc3ccc4ccccc4n3)c2)c(C(=O)O)c1C |
| InChI | InChI=1S/C34H31NO5/c1-3-29-23(2)33(34(36)37)32(19-31(29)39-20-24-10-5-4-6-11-24)40-21-25-12-9-14-28(18-25)38-22-27-17-16-26-13-7-8-15-30(26)35-27/h4-19H,3,20-22H2,1-2H3,(H,36,37) |
| InChIKey | UUOXLQKIBDGCTK-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |