C27H25NO5 — CID 141030054
3-ethyl-2-hydroxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid (PubChem CID 141030054) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-ethyl-2-hydroxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid.
| Compound Name | 3-ethyl-2-hydroxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 141030054 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 3-ethyl-2-hydroxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid |
| SMILES | CCc1c(OCc2cccc(OCc3ccc4ccccc4n3)c2)cc(C)c(C(=O)O)c1O |
| InChI | InChI=1S/C27H25NO5/c1-3-22-24(13-17(2)25(26(22)29)27(30)31)33-15-18-7-6-9-21(14-18)32-16-20-12-11-19-8-4-5-10-23(19)28-20/h4-14,29H,3,15-16H2,1-2H3,(H,30,31) |
| InChIKey | SYHOPCVGUATNEO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |