C28H27NO5 — CID 141030062
3-ethyl-2-methoxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid (PubChem CID 141030062) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-ethyl-2-methoxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid.
| Compound Name | 3-ethyl-2-methoxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 141030062 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 3-ethyl-2-methoxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid |
| SMILES | CCc1c(OCc2cccc(OCc3ccc4ccccc4n3)c2)cc(C)c(C(=O)O)c1OC |
| InChI | InChI=1S/C28H27NO5/c1-4-23-25(14-18(2)26(28(30)31)27(23)32-3)34-16-19-8-7-10-22(15-19)33-17-21-13-12-20-9-5-6-11-24(20)29-21/h5-15H,4,16-17H2,1-3H3,(H,30,31) |
| InChIKey | YVWKRKDKDYYHEL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |