About 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one
1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one (PubChem CID 141032191) has the molecular formula C5H8Cl2OS2
and a molecular weight of 219.16 g/mol. Its IUPAC name is 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one.
Molecular Properties
| Compound Name | 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one |
| PubChem CID | 141032191 |
| Molecular Formula | C5H8Cl2OS2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 217.94 |
| IUPAC Name | 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one |
| SMILES | O=C(C(S)CS)C(Cl)CCl |
| InChI | InChI=1S/C5H8Cl2OS2/c6-1-3(7)5(8)4(10)2-9/h3-4,9-10H,1-2H2 |
| InChIKey | PVMDLOPQLQTLHT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one?
The IUPAC name of 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one (CID 141032191) is 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one.
What is the SMILES notation for 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one?
The canonical SMILES for 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one is O=C(C(S)CS)C(Cl)CCl.
What is the InChIKey of 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one?
The InChIKey is PVMDLOPQLQTLHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8Cl2OS2/c6-1-3(7)5(8)4(10)2-9/h3-4,9-10H,1-2H2.
What are the key properties of 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one?
1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one has a molecular weight of 219.16 g/mol, XLogP of 1.63, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-4,5-bis(sulfanyl)pentan-3-one is sourced from PubChem (CID 141032191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).