About 4-chloro-1,1-bis(sulfanyl)butan-2-one
4-chloro-1,1-bis(sulfanyl)butan-2-one (PubChem CID 90471436) has the molecular formula C4H7ClOS2
and a molecular weight of 170.69 g/mol. Its IUPAC name is 4-chloro-1,1-bis(sulfanyl)butan-2-one.
Molecular Properties
| Compound Name | 4-chloro-1,1-bis(sulfanyl)butan-2-one |
| PubChem CID | 90471436 |
| Molecular Formula | C4H7ClOS2 |
| Molecular Weight | 170.69 g/mol |
| Exact Mass | 169.96 |
| IUPAC Name | 4-chloro-1,1-bis(sulfanyl)butan-2-one |
| SMILES | O=C(CCCl)C(S)S |
| InChI | InChI=1S/C4H7ClOS2/c5-2-1-3(6)4(7)8/h4,7-8H,1-2H2 |
| InChIKey | JLXCCSAEGNWZJQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1,1-bis(sulfanyl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,1-bis(sulfanyl)butan-2-one?
The IUPAC name of 4-chloro-1,1-bis(sulfanyl)butan-2-one (CID 90471436) is 4-chloro-1,1-bis(sulfanyl)butan-2-one.
What is the SMILES notation for 4-chloro-1,1-bis(sulfanyl)butan-2-one?
The canonical SMILES for 4-chloro-1,1-bis(sulfanyl)butan-2-one is O=C(CCCl)C(S)S.
What is the InChIKey of 4-chloro-1,1-bis(sulfanyl)butan-2-one?
The InChIKey is JLXCCSAEGNWZJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClOS2/c5-2-1-3(6)4(7)8/h4,7-8H,1-2H2.
What are the key properties of 4-chloro-1,1-bis(sulfanyl)butan-2-one?
4-chloro-1,1-bis(sulfanyl)butan-2-one has a molecular weight of 170.69 g/mol, XLogP of 1.37, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,1-bis(sulfanyl)butan-2-one is sourced from PubChem (CID 90471436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).