C29H24FNO2S — CID 141032225
3-(3-fluoro-4-tritylsulfanylphenyl)-4-methyl-1,3-oxazolidin-2-one (PubChem CID 141032225) has the molecular formula C29H24FNO2S and a molecular weight of 469.58 g/mol. Its IUPAC name is 3-(3-fluoro-4-tritylsulfanylphenyl)-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-fluoro-4-tritylsulfanylphenyl)-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141032225 |
| Molecular Formula | C29H24FNO2S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 3-(3-fluoro-4-tritylsulfanylphenyl)-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1COC(=O)N1c1ccc(SC(c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C29H24FNO2S/c1-21-20-33-28(32)31(21)25-17-18-27(26(30)19-25)34-29(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-19,21H,20H2,1H3 |
| InChIKey | MRDKPFSIBQNPPR-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|