C11H14N2O2 — CID 105458812
3-[2-(aminomethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 105458812) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-[2-(aminomethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(aminomethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 105458812 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-[2-(aminomethyl)phenyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1COC(=O)N1c1ccccc1CN |
| InChI | InChI=1S/C11H14N2O2/c1-8-7-15-11(14)13(8)10-5-3-2-4-9(10)6-12/h2-5,8H,6-7,12H2,1H3 |
| InChIKey | SWZKSMFBHBNEFL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |