C14H22N2 — CID 43199915
[2-(3,5-dimethylpiperidin-1-yl)phenyl]methanamine (PubChem CID 43199915) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is [2-(3,5-dimethylpiperidin-1-yl)phenyl]methanamine.
| Compound Name | [2-(3,5-dimethylpiperidin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 43199915 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | [2-(3,5-dimethylpiperidin-1-yl)phenyl]methanamine |
| SMILES | CC1CC(C)CN(c2ccccc2CN)C1 |
| InChI | InChI=1S/C14H22N2/c1-11-7-12(2)10-16(9-11)14-6-4-3-5-13(14)8-15/h3-6,11-12H,7-10,15H2,1-2H3 |
| InChIKey | JGMNTXGXZGCFCM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |