C14H21NO — CID 159772789
(3S,5R)-1-(2-methoxyphenyl)-3,5-dimethylpiperidine (PubChem CID 159772789) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (3S,5R)-1-(2-methoxyphenyl)-3,5-dimethylpiperidine.
| Compound Name | (3S,5R)-1-(2-methoxyphenyl)-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 159772789 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (3S,5R)-1-(2-methoxyphenyl)-3,5-dimethylpiperidine |
| SMILES | COc1ccccc1N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C14H21NO/c1-11-8-12(2)10-15(9-11)13-6-4-5-7-14(13)16-3/h4-7,11-12H,8-10H2,1-3H3/t11-,12+ |
| InChIKey | NGIKIFMVSBHNTA-TXEJJXNPSA-N |
| XLogP | 3.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |