C12H14N2O2 — CID 61038416
1-[2-(aminomethyl)phenyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 61038416) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-(aminomethyl)phenyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61038416 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[2-(aminomethyl)phenyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(c2ccccc2CN)C1=O |
| InChI | InChI=1S/C12H14N2O2/c1-8-6-11(15)14(12(8)16)10-5-3-2-4-9(10)7-13/h2-5,8H,6-7,13H2,1H3 |
| InChIKey | XCMPKQGRIYNIGV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|