C10H12N2O — CID 141032250
4-hydroxy-3-prop-1-enylbenzenecarboximidamide (PubChem CID 141032250) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-hydroxy-3-prop-1-enylbenzenecarboximidamide.
| Compound Name | 4-hydroxy-3-prop-1-enylbenzenecarboximidamide |
|---|---|
| PubChem CID | 141032250 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-hydroxy-3-prop-1-enylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(O)c(C=CC)c1 |
| InChI | InChI=1S/C10H12N2O/c1-2-3-7-6-8(10(11)12)4-5-9(7)13/h2-6,13H,1H3,(H3,11,12) |
| InChIKey | AZYUEGYLCDGFFD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|