C21H36O — CID 141032375
1-(4,4,7,7-tetramethyl-2-pentyl-1,3,5,6-tetrahydroinden-2-yl)prop-2-en-1-ol (PubChem CID 141032375) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-(4,4,7,7-tetramethyl-2-pentyl-1,3,5,6-tetrahydroinden-2-yl)prop-2-en-1-ol.
| Compound Name | 1-(4,4,7,7-tetramethyl-2-pentyl-1,3,5,6-tetrahydroinden-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 141032375 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 1-(4,4,7,7-tetramethyl-2-pentyl-1,3,5,6-tetrahydroinden-2-yl)prop-2-en-1-ol |
| SMILES | C=CC(O)C1(CCCCC)CC2=C(C1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C21H36O/c1-7-9-10-11-21(18(22)8-2)14-16-17(15-21)20(5,6)13-12-19(16,3)4/h8,18,22H,2,7,9-15H2,1,3-6H3 |
| InChIKey | GVMZUVVFJAJAFG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|