C19H32O2 — CID 141060580
3,3,7,7-tetramethyl-2-pentyl-1,4,5,6-tetrahydroindene-2-carboxylic acid (PubChem CID 141060580) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 3,3,7,7-tetramethyl-2-pentyl-1,4,5,6-tetrahydroindene-2-carboxylic acid.
| Compound Name | 3,3,7,7-tetramethyl-2-pentyl-1,4,5,6-tetrahydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 141060580 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 3,3,7,7-tetramethyl-2-pentyl-1,4,5,6-tetrahydroindene-2-carboxylic acid |
| SMILES | CCCCCC1(C(=O)O)CC2=C(CCCC2(C)C)C1(C)C |
| InChI | InChI=1S/C19H32O2/c1-6-7-8-12-19(16(20)21)13-15-14(18(19,4)5)10-9-11-17(15,2)3/h6-13H2,1-5H3,(H,20,21) |
| InChIKey | UFSBVCHQRCEQLU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|