C26H37NO3 — CID 86292551
4-[(4,4,7,7-tetramethyl-2-pentyl-1,3,5,6-tetrahydroindene-2-carbonyl)amino]benzoic acid (PubChem CID 86292551) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is 4-[(4,4,7,7-tetramethyl-2-pentyl-1,3,5,6-tetrahydroindene-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(4,4,7,7-tetramethyl-2-pentyl-1,3,5,6-tetrahydroindene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 86292551 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 4-[(4,4,7,7-tetramethyl-2-pentyl-1,3,5,6-tetrahydroindene-2-carbonyl)amino]benzoic acid |
| SMILES | CCCCCC1(C(=O)Nc2ccc(C(=O)O)cc2)CC2=C(C1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H37NO3/c1-6-7-8-13-26(23(30)27-19-11-9-18(10-12-19)22(28)29)16-20-21(17-26)25(4,5)15-14-24(20,2)3/h9-12H,6-8,13-17H2,1-5H3,(H,27,30)(H,28,29) |
| InChIKey | GEMCQFIQCJZTPW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|