C16H26O4 — CID 168756725
3,3-dibutylcyclohexene-1,2-dicarboxylic acid (PubChem CID 168756725) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 3,3-dibutylcyclohexene-1,2-dicarboxylic acid.
| Compound Name | 3,3-dibutylcyclohexene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 168756725 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3,3-dibutylcyclohexene-1,2-dicarboxylic acid |
| SMILES | CCCCC1(CCCC)CCCC(C(=O)O)=C1C(=O)O |
| InChI | InChI=1S/C16H26O4/c1-3-5-9-16(10-6-4-2)11-7-8-12(14(17)18)13(16)15(19)20/h3-11H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | WUURFOYZFPFEER-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |