About 3-butylcyclohex-2-ene-1,1-dicarboxylic acid
3-butylcyclohex-2-ene-1,1-dicarboxylic acid (PubChem CID 152526490) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-butylcyclohex-2-ene-1,1-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-butylcyclohex-2-ene-1,1-dicarboxylic acid |
| PubChem CID | 152526490 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-butylcyclohex-2-ene-1,1-dicarboxylic acid |
| SMILES | CCCCC1=CC(C(=O)O)(C(=O)O)CCC1 |
| InChI | InChI=1S/C12H18O4/c1-2-3-5-9-6-4-7-12(8-9,10(13)14)11(15)16/h8H,2-7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | YIPZEXWLIZXSKT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-butylcyclohex-2-ene-1,1-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylcyclohex-2-ene-1,1-dicarboxylic acid?
The IUPAC name of 3-butylcyclohex-2-ene-1,1-dicarboxylic acid (CID 152526490) is 3-butylcyclohex-2-ene-1,1-dicarboxylic acid.
What is the SMILES notation for 3-butylcyclohex-2-ene-1,1-dicarboxylic acid?
The canonical SMILES for 3-butylcyclohex-2-ene-1,1-dicarboxylic acid is CCCCC1=CC(C(=O)O)(C(=O)O)CCC1.
What is the InChIKey of 3-butylcyclohex-2-ene-1,1-dicarboxylic acid?
The InChIKey is YIPZEXWLIZXSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-2-3-5-9-6-4-7-12(8-9,10(13)14)11(15)16/h8H,2-7H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 3-butylcyclohex-2-ene-1,1-dicarboxylic acid?
3-butylcyclohex-2-ene-1,1-dicarboxylic acid has a molecular weight of 226.27 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylcyclohex-2-ene-1,1-dicarboxylic acid is sourced from PubChem (CID 152526490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).