About cyclobutanone;undecanoic acid
cyclobutanone;undecanoic acid (PubChem CID 53445946) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is cyclobutanone;undecanoic acid.
Molecular Properties
| Compound Name | cyclobutanone;undecanoic acid |
| PubChem CID | 53445946 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | cyclobutanone;undecanoic acid |
| SMILES | CCCCCCCCCCC(=O)O.O=C1CCC1 |
| InChI | InChI=1S/C11H22O2.C4H6O/c1-2-3-4-5-6-7-8-9-10-11(12)13;5-4-2-1-3-4/h2-10H2,1H3,(H,12,13);1-3H2 |
| InChIKey | JGRHUZFZBIGIAE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclobutanone;undecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutanone;undecanoic acid?
The IUPAC name of cyclobutanone;undecanoic acid (CID 53445946) is cyclobutanone;undecanoic acid.
What is the SMILES notation for cyclobutanone;undecanoic acid?
The canonical SMILES for cyclobutanone;undecanoic acid is CCCCCCCCCCC(=O)O.O=C1CCC1.
What is the InChIKey of cyclobutanone;undecanoic acid?
The InChIKey is JGRHUZFZBIGIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2.C4H6O/c1-2-3-4-5-6-7-8-9-10-11(12)13;5-4-2-1-3-4/h2-10H2,1H3,(H,12,13);1-3H2.
What are the key properties of cyclobutanone;undecanoic acid?
cyclobutanone;undecanoic acid has a molecular weight of 256.39 g/mol, XLogP of 4.34, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutanone;undecanoic acid is sourced from PubChem (CID 53445946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).