C19H18N4OS — CID 141036720
1-(furan-2-yl)-2-pyrrolidin-1-yl-4-(1H-pyrrol-2-yl)-5-thiophen-2-ylimidazole (PubChem CID 141036720) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-pyrrolidin-1-yl-4-(1H-pyrrol-2-yl)-5-thiophen-2-ylimidazole.
| Compound Name | 1-(furan-2-yl)-2-pyrrolidin-1-yl-4-(1H-pyrrol-2-yl)-5-thiophen-2-ylimidazole |
|---|---|
| PubChem CID | 141036720 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(furan-2-yl)-2-pyrrolidin-1-yl-4-(1H-pyrrol-2-yl)-5-thiophen-2-ylimidazole |
| SMILES | c1c[nH]c(-c2nc(N3CCCC3)n(-c3ccco3)c2-c2cccs2)c1 |
| InChI | InChI=1S/C19H18N4OS/c1-2-11-22(10-1)19-21-17(14-6-3-9-20-14)18(15-7-5-13-25-15)23(19)16-8-4-12-24-16/h3-9,12-13,20H,1-2,10-11H2 |
| InChIKey | JONWRVSHZHBKJL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 49.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |