C28H25N7OS2 — CID 141099672
2-[1-cyclohex-2-en-1-ylsulfanyl-3-(furan-2-yl)-2-(1H-pyrazol-5-yl)-5-(1H-pyrrol-2-yl)-4-thiophen-2-ylimidazol-2-yl]pyrimidine (PubChem CID 141099672) has the molecular formula C28H25N7OS2 and a molecular weight of 539.69 g/mol. Its IUPAC name is 2-[1-cyclohex-2-en-1-ylsulfanyl-3-(furan-2-yl)-2-(1H-pyrazol-5-yl)-5-(1H-pyrrol-2-yl)-4-thiophen-2-ylimidazol-2-yl]pyrimidine.
| Compound Name | 2-[1-cyclohex-2-en-1-ylsulfanyl-3-(furan-2-yl)-2-(1H-pyrazol-5-yl)-5-(1H-pyrrol-2-yl)-4-thiophen-2-ylimidazol-2-yl]pyrimidine |
|---|---|
| PubChem CID | 141099672 |
| Molecular Formula | C28H25N7OS2 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-[1-cyclohex-2-en-1-ylsulfanyl-3-(furan-2-yl)-2-(1H-pyrazol-5-yl)-5-(1H-pyrrol-2-yl)-4-thiophen-2-ylimidazol-2-yl]pyrimidine |
| SMILES | C1=CC(SN2C(c3ccc[nH]3)=C(c3cccs3)N(c3ccco3)C2(c2ncccn2)c2ccn[nH]2)CCC1 |
| InChI | InChI=1S/C28H25N7OS2/c1-2-8-20(9-3-1)38-35-25(21-10-4-14-29-21)26(22-11-6-19-37-22)34(24-12-5-18-36-24)28(35,23-13-17-32-33-23)27-30-15-7-16-31-27/h2,4-8,10-20,29H,1,3,9H2,(H,32,33) |
| InChIKey | PXUVTZNDUYEQTN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|