C9H22O7Si — CID 141039341
1,2-dihydroxy-6-trimethoxysilylhexan-3-one;hydrate (PubChem CID 141039341) has the molecular formula C9H22O7Si and a molecular weight of 270.35 g/mol. Its IUPAC name is 1,2-dihydroxy-6-trimethoxysilylhexan-3-one;hydrate.
| Compound Name | 1,2-dihydroxy-6-trimethoxysilylhexan-3-one;hydrate |
|---|---|
| PubChem CID | 141039341 |
| Molecular Formula | C9H22O7Si |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1,2-dihydroxy-6-trimethoxysilylhexan-3-one;hydrate |
| SMILES | CO[Si](CCCC(=O)C(O)CO)(OC)OC.O |
| InChI | InChI=1S/C9H20O6Si.H2O/c1-13-16(14-2,15-3)6-4-5-8(11)9(12)7-10;/h9-10,12H,4-7H2,1-3H3;1H2 |
| InChIKey | AHFWCBXHWVEAAM-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|