C22H23NO3 — CID 141039503
ethyl 2-[1-[(4-hydroxyphenyl)methyl]-4-phenylpyrrol-3-yl]propanoate (PubChem CID 141039503) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 2-[1-[(4-hydroxyphenyl)methyl]-4-phenylpyrrol-3-yl]propanoate.
| Compound Name | ethyl 2-[1-[(4-hydroxyphenyl)methyl]-4-phenylpyrrol-3-yl]propanoate |
|---|---|
| PubChem CID | 141039503 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | ethyl 2-[1-[(4-hydroxyphenyl)methyl]-4-phenylpyrrol-3-yl]propanoate |
| SMILES | CCOC(=O)C(C)c1cn(Cc2ccc(O)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c1-3-26-22(25)16(2)20-14-23(13-17-9-11-19(24)12-10-17)15-21(20)18-7-5-4-6-8-18/h4-12,14-16,24H,3,13H2,1-2H3 |
| InChIKey | QQTGABPLQLQBOV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |