C13H21NO5 — CID 141040486
ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate (PubChem CID 141040486) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate.
| Compound Name | ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate |
|---|---|
| PubChem CID | 141040486 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate |
| SMILES | CCOC(=O)CN(C=O)C1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C13H21NO5/c1-2-17-12(16)9-14(10-15)11-4-3-5-13(8-11)18-6-7-19-13/h10-11H,2-9H2,1H3 |
| InChIKey | HDFBWIRNUYUMET-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|