ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate

C13H21NO5 — CID 141040486

IUPACethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate
SMILESCCOC(=O)CN(C=O)C1CCCC2(C1)OCCO2
InChIInChI=1S/C13H21NO5/c1-2-17-12(16)9-14(10-15)11-4-3-5-13(8-11)18-6-7-19-13/h10-11H,2-9H2,1H3
InChIKeyHDFBWIRNUYUMET-UHFFFAOYSA-N
MW271.31 g/mol
LogP0.69
Rot. Bonds5

About ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate

ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate (PubChem CID 141040486) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate.

Molecular Properties

Compound Nameethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate
PubChem CID141040486
Molecular FormulaC13H21NO5
Molecular Weight271.31 g/mol
Exact Mass271.14
IUPAC Nameethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate
SMILESCCOC(=O)CN(C=O)C1CCCC2(C1)OCCO2
InChIInChI=1S/C13H21NO5/c1-2-17-12(16)9-14(10-15)11-4-3-5-13(8-11)18-6-7-19-13/h10-11H,2-9H2,1H3
InChIKeyHDFBWIRNUYUMET-UHFFFAOYSA-N
XLogP0.69
TPSA65.07 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.31
LogP ≤ 50.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate?
The IUPAC name of ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate (CID 141040486) is ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate.
What is the SMILES notation for ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate?
The canonical SMILES for ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate is CCOC(=O)CN(C=O)C1CCCC2(C1)OCCO2.
What is the InChIKey of ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate?
The InChIKey is HDFBWIRNUYUMET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO5/c1-2-17-12(16)9-14(10-15)11-4-3-5-13(8-11)18-6-7-19-13/h10-11H,2-9H2,1H3.
What are the key properties of ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate?
ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate has a molecular weight of 271.31 g/mol, XLogP of 0.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1,4-dioxaspiro[4.5]decan-7-yl(formyl)amino]acetate is sourced from PubChem (CID 141040486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).