C13H20O3 — CID 143238656
(2E)-2-(1,4-dioxaspiro[4.5]decan-7-ylmethylidene)butanal (PubChem CID 143238656) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (2E)-2-(1,4-dioxaspiro[4.5]decan-7-ylmethylidene)butanal.
| Compound Name | (2E)-2-(1,4-dioxaspiro[4.5]decan-7-ylmethylidene)butanal |
|---|---|
| PubChem CID | 143238656 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2E)-2-(1,4-dioxaspiro[4.5]decan-7-ylmethylidene)butanal |
| SMILES | CC/C(C=O)=C\C1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C13H20O3/c1-2-11(10-14)8-12-4-3-5-13(9-12)15-6-7-16-13/h8,10,12H,2-7,9H2,1H3/b11-8+ |
| InChIKey | RRPCHSDWVHOKAU-DHZHZOJOSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|