docosa-2,4,6,8-tetraen-18-ynoic acid

C22H32O2 — CID 141041074

IUPACdocosa-2,4,6,8-tetraen-18-ynoic acid
SMILESCCCC#CCCCCCCCCC=CC=CC=CC=CC(=O)O
InChIInChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h14-21H,2-3,6-13H2,1H3,(H,23,24)
InChIKeyAQKGVOUHCUUSEC-UHFFFAOYSA-N
MW328.50 g/mol
LogP6.22
Rot. Bonds13

About docosa-2,4,6,8-tetraen-18-ynoic acid

docosa-2,4,6,8-tetraen-18-ynoic acid (PubChem CID 141041074) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is docosa-2,4,6,8-tetraen-18-ynoic acid.

Molecular Properties

Compound Namedocosa-2,4,6,8-tetraen-18-ynoic acid
PubChem CID141041074
Molecular FormulaC22H32O2
Molecular Weight328.50 g/mol
Exact Mass328.24
IUPAC Namedocosa-2,4,6,8-tetraen-18-ynoic acid
SMILESCCCC#CCCCCCCCCC=CC=CC=CC=CC(=O)O
InChIInChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h14-21H,2-3,6-13H2,1H3,(H,23,24)
InChIKeyAQKGVOUHCUUSEC-UHFFFAOYSA-N
XLogP6.22
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500328.50
LogP ≤ 56.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze docosa-2,4,6,8-tetraen-18-ynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of docosa-2,4,6,8-tetraen-18-ynoic acid?
The IUPAC name of docosa-2,4,6,8-tetraen-18-ynoic acid (CID 141041074) is docosa-2,4,6,8-tetraen-18-ynoic acid.
What is the SMILES notation for docosa-2,4,6,8-tetraen-18-ynoic acid?
The canonical SMILES for docosa-2,4,6,8-tetraen-18-ynoic acid is CCCC#CCCCCCCCCC=CC=CC=CC=CC(=O)O.
What is the InChIKey of docosa-2,4,6,8-tetraen-18-ynoic acid?
The InChIKey is AQKGVOUHCUUSEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h14-21H,2-3,6-13H2,1H3,(H,23,24).
What are the key properties of docosa-2,4,6,8-tetraen-18-ynoic acid?
docosa-2,4,6,8-tetraen-18-ynoic acid has a molecular weight of 328.50 g/mol, XLogP of 6.22, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docosa-2,4,6,8-tetraen-18-ynoic acid is sourced from PubChem (CID 141041074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).