About tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate
tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate (PubChem CID 141042068) has the molecular formula C60H78I3O7P
and a molecular weight of 1322.96 g/mol. Its IUPAC name is tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate.
Molecular Properties
| Compound Name | tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate |
| PubChem CID | 141042068 |
| Molecular Formula | C60H78I3O7P |
| Molecular Weight | 1322.96 g/mol |
| Exact Mass | 1322.26 |
| IUPAC Name | tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate |
| SMILES | CCCCCCCCOc1ccc(I(OP(=O)(OI(c2ccccc2)c2ccc(OCCCCCCCC)cc2)OI(c2ccccc2)c2ccc(OCCCCCCCC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C60H78I3O7P/c1-4-7-10-13-16-28-49-65-58-43-37-55(38-44-58)61(52-31-22-19-23-32-52)68-71(64,69-62(53-33-24-20-25-34-53)56-39-45-59(46-40-56)66-50-29-17-14-11-8-5-2)70-63(54-35-26-21-27-36-54)57-41-47-60(48-42-57)67-51-30-18-15-12-9-6-3/h19-27,31-48H,4-18,28-30,49-51H2,1-3H3 |
| InChIKey | PSBMAIGJWLXPGZ-UHFFFAOYSA-N |
| XLogP | 19.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1322.96 |
| LogP ≤ 5 | 19.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate?
The IUPAC name of tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate (CID 141042068) is tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate.
What is the SMILES notation for tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate?
The canonical SMILES for tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate is CCCCCCCCOc1ccc(I(OP(=O)(OI(c2ccccc2)c2ccc(OCCCCCCCC)cc2)OI(c2ccccc2)c2ccc(OCCCCCCCC)cc2)c2ccccc2)cc1.
What is the InChIKey of tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate?
The InChIKey is PSBMAIGJWLXPGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H78I3O7P/c1-4-7-10-13-16-28-49-65-58-43-37-55(38-44-58)61(52-31-22-19-23-32-52)68-71(64,69-62(53-33-24-20-25-34-53)56-39-45-59(46-40-56)66-50-29-17-14-11-8-5-2)70-63(54-35-26-21-27-36-54)57-41-47-60(48-42-57)67-51-30-18-15-12-9-6-3/h19-27,31-48H,4-18,28-30,49-51H2,1-3H3.
What are the key properties of tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate?
tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate has a molecular weight of 1322.96 g/mol, XLogP of 19.85, 36 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(4-octoxyphenyl)-phenyl-λ3-iodanyl] phosphate is sourced from PubChem (CID 141042068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).