C14H10N4OS — CID 141042261
5-(furan-2-yl)-3-(1H-imidazol-2-yl)-4-thiophen-2-yl-1H-pyrazole (PubChem CID 141042261) has the molecular formula C14H10N4OS and a molecular weight of 282.33 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-(1H-imidazol-2-yl)-4-thiophen-2-yl-1H-pyrazole.
| Compound Name | 5-(furan-2-yl)-3-(1H-imidazol-2-yl)-4-thiophen-2-yl-1H-pyrazole |
|---|---|
| PubChem CID | 141042261 |
| Molecular Formula | C14H10N4OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-(furan-2-yl)-3-(1H-imidazol-2-yl)-4-thiophen-2-yl-1H-pyrazole |
| SMILES | c1coc(-c2[nH]nc(-c3ncc[nH]3)c2-c2cccs2)c1 |
| InChI | InChI=1S/C14H10N4OS/c1-3-9(19-7-1)12-11(10-4-2-8-20-10)13(18-17-12)14-15-5-6-16-14/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | BVXYRFDNCISJSZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |