C18HBF14O2 — CID 141042479
(2,3,4,5,6-pentafluorophenyl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]borinic acid (PubChem CID 141042479) has the molecular formula C18HBF14O2 and a molecular weight of 525.99 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]borinic acid.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]borinic acid |
|---|---|
| PubChem CID | 141042479 |
| Molecular Formula | C18HBF14O2 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]borinic acid |
| SMILES | OB(Oc1c(F)c(F)c(F)c(F)c1-c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18HBF14O2/c20-4-1(5(21)10(26)14(30)9(4)25)2-6(22)11(27)16(32)17(33)18(2)35-19(34)3-7(23)12(28)15(31)13(29)8(3)24/h34H |
| InChIKey | AWQZBNOZEGGOKZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|