About 2,4-dihydroxyhexan-2-yl 2-methylpropanoate
2,4-dihydroxyhexan-2-yl 2-methylpropanoate (PubChem CID 141043287) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,4-dihydroxyhexan-2-yl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2,4-dihydroxyhexan-2-yl 2-methylpropanoate |
| PubChem CID | 141043287 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2,4-dihydroxyhexan-2-yl 2-methylpropanoate |
| SMILES | CCC(O)CC(C)(O)OC(=O)C(C)C |
| InChI | InChI=1S/C10H20O4/c1-5-8(11)6-10(4,13)14-9(12)7(2)3/h7-8,11,13H,5-6H2,1-4H3 |
| InChIKey | SYMWMIPNLJBWLU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihydroxyhexan-2-yl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroxyhexan-2-yl 2-methylpropanoate?
The IUPAC name of 2,4-dihydroxyhexan-2-yl 2-methylpropanoate (CID 141043287) is 2,4-dihydroxyhexan-2-yl 2-methylpropanoate.
What is the SMILES notation for 2,4-dihydroxyhexan-2-yl 2-methylpropanoate?
The canonical SMILES for 2,4-dihydroxyhexan-2-yl 2-methylpropanoate is CCC(O)CC(C)(O)OC(=O)C(C)C.
What is the InChIKey of 2,4-dihydroxyhexan-2-yl 2-methylpropanoate?
The InChIKey is SYMWMIPNLJBWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-5-8(11)6-10(4,13)14-9(12)7(2)3/h7-8,11,13H,5-6H2,1-4H3.
What are the key properties of 2,4-dihydroxyhexan-2-yl 2-methylpropanoate?
2,4-dihydroxyhexan-2-yl 2-methylpropanoate has a molecular weight of 204.27 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxyhexan-2-yl 2-methylpropanoate is sourced from PubChem (CID 141043287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).