C24H24FN3O2 — CID 141044305
1-[4-[5-(2-fluorophenyl)-2-pyridinyl]piperazin-1-yl]-2-phenylmethoxyethanone (PubChem CID 141044305) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-[4-[5-(2-fluorophenyl)-2-pyridinyl]piperazin-1-yl]-2-phenylmethoxyethanone.
| Compound Name | 1-[4-[5-(2-fluorophenyl)-2-pyridinyl]piperazin-1-yl]-2-phenylmethoxyethanone |
|---|---|
| PubChem CID | 141044305 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-[4-[5-(2-fluorophenyl)-2-pyridinyl]piperazin-1-yl]-2-phenylmethoxyethanone |
| SMILES | O=C(COCc1ccccc1)N1CCN(c2ccc(-c3ccccc3F)cn2)CC1 |
| InChI | InChI=1S/C24H24FN3O2/c25-22-9-5-4-8-21(22)20-10-11-23(26-16-20)27-12-14-28(15-13-27)24(29)18-30-17-19-6-2-1-3-7-19/h1-11,16H,12-15,17-18H2 |
| InChIKey | AUJHHGOUGDESBD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |