C15H13ClINO2 — CID 141045951
3-(5-chloro-2-methoxyphenyl)-6-iodo-1,2-dihydroindol-3-ol (PubChem CID 141045951) has the molecular formula C15H13ClINO2 and a molecular weight of 401.63 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-6-iodo-1,2-dihydroindol-3-ol.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-6-iodo-1,2-dihydroindol-3-ol |
|---|---|
| PubChem CID | 141045951 |
| Molecular Formula | C15H13ClINO2 |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-6-iodo-1,2-dihydroindol-3-ol |
| SMILES | COc1ccc(Cl)cc1C1(O)CNc2cc(I)ccc21 |
| InChI | InChI=1S/C15H13ClINO2/c1-20-14-5-2-9(16)6-12(14)15(19)8-18-13-7-10(17)3-4-11(13)15/h2-7,18-19H,8H2,1H3 |
| InChIKey | RFCYJJASVUFYKB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|